C19H19NO5S — CID 8766105
1,3-benzodioxol-5-yl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate (PubChem CID 8766105) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 8766105 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanylbenzoate |
| SMILES | CC(C)NC(=O)CSc1ccccc1C(=O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19NO5S/c1-12(2)20-18(21)10-26-17-6-4-3-5-14(17)19(22)25-13-7-8-15-16(9-13)24-11-23-15/h3-9,12H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | QVMVECWLYUQKMD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|