C22H36N6 — CID 87661103
2-[1-[4-[(2R)-2-methylpyrrolidin-1-yl]butyl]-3-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]imidazolidin-2-ylidene]propanedinitrile (PubChem CID 87661103) has the molecular formula C22H36N6 and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-[1-[4-[(2R)-2-methylpyrrolidin-1-yl]butyl]-3-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]imidazolidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[1-[4-[(2R)-2-methylpyrrolidin-1-yl]butyl]-3-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]imidazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 87661103 |
| Molecular Formula | C22H36N6 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-[1-[4-[(2R)-2-methylpyrrolidin-1-yl]butyl]-3-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]imidazolidin-2-ylidene]propanedinitrile |
| SMILES | C[C@@H]1CCCN1CCCCN1CCN(CCN2CCC[C@H]2C)C1=C(C#N)C#N |
| InChI | InChI=1S/C22H36N6/c1-19-7-5-11-25(19)9-3-4-10-27-15-16-28(22(27)21(17-23)18-24)14-13-26-12-6-8-20(26)2/h19-20H,3-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | XFVJTMPJTVLDKK-WOJBJXKFSA-N |
| XLogP | 2.61 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|