C23H38N6 — CID 76603664
2-isocyano-2-[1-[3-(2-methylpiperidin-1-yl)propyl]-3-(3-piperidin-1-ylpropyl)imidazolidin-2-ylidene]acetonitrile (PubChem CID 76603664) has the molecular formula C23H38N6 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-isocyano-2-[1-[3-(2-methylpiperidin-1-yl)propyl]-3-(3-piperidin-1-ylpropyl)imidazolidin-2-ylidene]acetonitrile.
| Compound Name | 2-isocyano-2-[1-[3-(2-methylpiperidin-1-yl)propyl]-3-(3-piperidin-1-ylpropyl)imidazolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 76603664 |
| Molecular Formula | C23H38N6 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | 2-isocyano-2-[1-[3-(2-methylpiperidin-1-yl)propyl]-3-(3-piperidin-1-ylpropyl)imidazolidin-2-ylidene]acetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1N(CCCN2CCCCC2)CCN1CCCN1CCCCC1C |
| InChI | InChI=1S/C23H38N6/c1-21-10-4-7-14-27(21)15-9-17-29-19-18-28(23(29)22(20-24)25-2)16-8-13-26-11-5-3-6-12-26/h21H,3-19H2,1H3 |
| InChIKey | UQKGQYPFVQZEOD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|