C23H36N6 — CID 76603656
2-[1-[3-(azepan-1-yl)propyl]-3-[3-(3,6-dihydro-2H-pyridin-1-yl)propyl]imidazolidin-2-ylidene]-2-isocyanoacetonitrile (PubChem CID 76603656) has the molecular formula C23H36N6 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-[1-[3-(azepan-1-yl)propyl]-3-[3-(3,6-dihydro-2H-pyridin-1-yl)propyl]imidazolidin-2-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[1-[3-(azepan-1-yl)propyl]-3-[3-(3,6-dihydro-2H-pyridin-1-yl)propyl]imidazolidin-2-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 76603656 |
| Molecular Formula | C23H36N6 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-[1-[3-(azepan-1-yl)propyl]-3-[3-(3,6-dihydro-2H-pyridin-1-yl)propyl]imidazolidin-2-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1N(CCCN2CC=CCC2)CCN1CCCN1CCCCCC1 |
| InChI | InChI=1S/C23H36N6/c1-25-22(21-24)23-28(17-9-15-26-11-5-2-3-6-12-26)19-20-29(23)18-10-16-27-13-7-4-8-14-27/h4,7H,2-3,5-6,8-20H2 |
| InChIKey | NDEBEEYOPVRSBN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|