C23H36N6 — CID 87662326
2-[3-(3-piperidin-1-ylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)-4H-pyrimidin-2-ylidene]propanedinitrile (PubChem CID 87662326) has the molecular formula C23H36N6 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-[3-(3-piperidin-1-ylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)-4H-pyrimidin-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-(3-piperidin-1-ylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)-4H-pyrimidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 87662326 |
| Molecular Formula | C23H36N6 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-[3-(3-piperidin-1-ylpropyl)-1-(1-propan-2-ylpiperidin-4-yl)-4H-pyrimidin-2-ylidene]propanedinitrile |
| SMILES | CC(C)N1CCC(N2C=CCN(CCCN3CCCCC3)C2=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C23H36N6/c1-20(2)27-16-8-22(9-17-27)29-15-7-14-28(23(29)21(18-24)19-25)13-6-12-26-10-4-3-5-11-26/h7,15,20,22H,3-6,8-14,16-17H2,1-2H3 |
| InChIKey | PVKPILKNUKTDBM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|