C31H46N6O8 — CID 86632471
bis((E)-but-2-enedioic acid);2-[1-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-3-(2-piperidin-1-ylethyl)imidazolidin-2-ylidene]propanedinitrile (PubChem CID 86632471) has the molecular formula C31H46N6O8 and a molecular weight of 630.74 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-[1-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-3-(2-piperidin-1-ylethyl)imidazolidin-2-ylidene]propanedinitrile.
| Compound Name | bis((E)-but-2-enedioic acid);2-[1-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-3-(2-piperidin-1-ylethyl)imidazolidin-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 86632471 |
| Molecular Formula | C31H46N6O8 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-[1-[3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propyl]-3-(2-piperidin-1-ylethyl)imidazolidin-2-ylidene]propanedinitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCN1CCN(CCN2CCCCC2)C1=C(C#N)C#N.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H38N6.2C4H4O4/c1-20-8-6-9-21(2)29(20)13-7-12-27-16-17-28(23(27)22(18-24)19-25)15-14-26-10-4-3-5-11-26;2*5-3(6)1-2-4(7)8/h20-21H,3-17H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+/t20-,21+;; |
| InChIKey | XBFGUCZORHCDRA-FDZRMPRGSA-N |
| XLogP | 2.43 |
| TPSA | 209.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|