C34H38N6O — CID 22888169
N-[2-[(2E)-2-[cyano(isocyano)methylidene]-3-(naphthalen-1-ylmethyl)imidazolidin-1-yl]ethyl]-N-ethyl-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 22888169) has the molecular formula C34H38N6O and a molecular weight of 546.72 g/mol. Its IUPAC name is N-[2-[(2E)-2-[cyano(isocyano)methylidene]-3-(naphthalen-1-ylmethyl)imidazolidin-1-yl]ethyl]-N-ethyl-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[2-[(2E)-2-[cyano(isocyano)methylidene]-3-(naphthalen-1-ylmethyl)imidazolidin-1-yl]ethyl]-N-ethyl-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 22888169 |
| Molecular Formula | C34H38N6O |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | N-[2-[(2E)-2-[cyano(isocyano)methylidene]-3-(naphthalen-1-ylmethyl)imidazolidin-1-yl]ethyl]-N-ethyl-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | [C-]#[N+]/C(C#N)=C1/N(CCN(CC)C(=O)c2ccc(CN3CCCCC3)cc2)CCN1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C34H38N6O/c1-3-38(34(41)29-16-14-27(15-17-29)25-37-18-7-4-8-19-37)20-21-39-22-23-40(33(39)32(24-35)36-2)26-30-12-9-11-28-10-5-6-13-31(28)30/h5-6,9-17H,3-4,7-8,18-23,25-26H2,1H3/b33-32- |
| InChIKey | WNBURQBHVXNZGC-KARKAFJISA-N |
| XLogP | 5.72 |
| TPSA | 58.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|