C32H33ClN2O — CID 69215709
N-[[6-(azepan-1-ylmethyl)naphthalen-1-yl]methyl]-4-(4-chlorophenyl)-N-methylbenzamide (PubChem CID 69215709) has the molecular formula C32H33ClN2O and a molecular weight of 497.08 g/mol. Its IUPAC name is N-[[6-(azepan-1-ylmethyl)naphthalen-1-yl]methyl]-4-(4-chlorophenyl)-N-methylbenzamide.
| Compound Name | N-[[6-(azepan-1-ylmethyl)naphthalen-1-yl]methyl]-4-(4-chlorophenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 69215709 |
| Molecular Formula | C32H33ClN2O |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[[6-(azepan-1-ylmethyl)naphthalen-1-yl]methyl]-4-(4-chlorophenyl)-N-methylbenzamide |
| SMILES | CN(Cc1cccc2cc(CN3CCCCCC3)ccc12)C(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H33ClN2O/c1-34(32(36)27-12-10-25(11-13-27)26-14-16-30(33)17-15-26)23-29-8-6-7-28-21-24(9-18-31(28)29)22-35-19-4-2-3-5-20-35/h6-18,21H,2-5,19-20,22-23H2,1H3 |
| InChIKey | LFHHHAVCIAQNEN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |