C23H40O8 — CID 87662138
2,2-bis(hexanoyloxymethyl)nonanedioic acid (PubChem CID 87662138) has the molecular formula C23H40O8 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2,2-bis(hexanoyloxymethyl)nonanedioic acid.
| Compound Name | 2,2-bis(hexanoyloxymethyl)nonanedioic acid |
|---|---|
| PubChem CID | 87662138 |
| Molecular Formula | C23H40O8 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 2,2-bis(hexanoyloxymethyl)nonanedioic acid |
| SMILES | CCCCCC(=O)OCC(CCCCCCC(=O)O)(COC(=O)CCCCC)C(=O)O |
| InChI | InChI=1S/C23H40O8/c1-3-5-9-14-20(26)30-17-23(22(28)29,16-12-8-7-11-13-19(24)25)18-31-21(27)15-10-6-4-2/h3-18H2,1-2H3,(H,24,25)(H,28,29) |
| InChIKey | FZMHFLHGIUSUGW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|