C18H12F3N3O4 — CID 87662996
1-[6-(5-formyl-2-methoxyphenyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 87662996) has the molecular formula C18H12F3N3O4 and a molecular weight of 391.31 g/mol. Its IUPAC name is 1-[6-(5-formyl-2-methoxyphenyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-[6-(5-formyl-2-methoxyphenyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 87662996 |
| Molecular Formula | C18H12F3N3O4 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-[6-(5-formyl-2-methoxyphenyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | COc1ccc(C=O)cc1-c1cccc(-n2ncc(C(=O)O)c2C(F)(F)F)n1 |
| InChI | InChI=1S/C18H12F3N3O4/c1-28-14-6-5-10(9-25)7-11(14)13-3-2-4-15(23-13)24-16(18(19,20)21)12(8-22-24)17(26)27/h2-9H,1H3,(H,26,27) |
| InChIKey | PENQFBACZGTHDC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|