C11H7ClF3N3O3 — CID 176658898
1-(5-chloro-6-methoxy-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 176658898) has the molecular formula C11H7ClF3N3O3 and a molecular weight of 321.64 g/mol. Its IUPAC name is 1-(5-chloro-6-methoxy-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(5-chloro-6-methoxy-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 176658898 |
| Molecular Formula | C11H7ClF3N3O3 |
| Molecular Weight | 321.64 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 1-(5-chloro-6-methoxy-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | COc1nc(-n2ncc(C(=O)O)c2C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H7ClF3N3O3/c1-21-9-6(12)2-3-7(17-9)18-8(11(13,14)15)5(4-16-18)10(19)20/h2-4H,1H3,(H,19,20) |
| InChIKey | KFVSRSSUPBUTDW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |