C11H7F4N3O2 — CID 146285397
1-(5-fluoro-6-methyl-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 146285397) has the molecular formula C11H7F4N3O2 and a molecular weight of 289.19 g/mol. Its IUPAC name is 1-(5-fluoro-6-methyl-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(5-fluoro-6-methyl-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146285397 |
| Molecular Formula | C11H7F4N3O2 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(5-fluoro-6-methyl-2-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | Cc1nc(-n2ncc(C(=O)O)c2C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H7F4N3O2/c1-5-7(12)2-3-8(17-5)18-9(11(13,14)15)6(4-16-18)10(19)20/h2-4H,1H3,(H,19,20) |
| InChIKey | LVFBALUEDWIXHH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |