C27H29F7N2O2S — CID 87664975
(3S,4S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-3-(4-fluoro-2-methylphenyl)-1-(1-oxothietan-3-yl)piperidine-4-carboxamide (PubChem CID 87664975) has the molecular formula C27H29F7N2O2S and a molecular weight of 578.59 g/mol. Its IUPAC name is (3S,4S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-3-(4-fluoro-2-methylphenyl)-1-(1-oxothietan-3-yl)piperidine-4-carboxamide.
| Compound Name | (3S,4S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-3-(4-fluoro-2-methylphenyl)-1-(1-oxothietan-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87664975 |
| Molecular Formula | C27H29F7N2O2S |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | (3S,4S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-3-(4-fluoro-2-methylphenyl)-1-(1-oxothietan-3-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(F)ccc1[C@H]1CN(C2CS(=O)C2)CC[C@@H]1C(=O)NCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F7N2O2S/c1-16-9-20(28)4-5-22(16)24-13-36(21-14-39(38)15-21)8-6-23(24)25(37)35-7-2-3-17-10-18(26(29,30)31)12-19(11-17)27(32,33)34/h4-5,9-12,21,23-24H,2-3,6-8,13-15H2,1H3,(H,35,37)/t21?,23-,24+,39?/m0/s1 |
| InChIKey | LAARIOARINISIR-RSYZFYFRSA-N |
| XLogP | 5.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|