C18H23N5O2S2 — CID 8766554
1-(2-morpholin-4-ylethyl)-3-[(2-quinolin-8-ylsulfanylacetyl)amino]thiourea (PubChem CID 8766554) has the molecular formula C18H23N5O2S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[(2-quinolin-8-ylsulfanylacetyl)amino]thiourea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[(2-quinolin-8-ylsulfanylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 8766554 |
| Molecular Formula | C18H23N5O2S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[(2-quinolin-8-ylsulfanylacetyl)amino]thiourea |
| SMILES | O=C(CSc1cccc2cccnc12)NNC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H23N5O2S2/c24-16(13-27-15-5-1-3-14-4-2-6-19-17(14)15)21-22-18(26)20-7-8-23-9-11-25-12-10-23/h1-6H,7-13H2,(H,21,24)(H2,20,22,26) |
| InChIKey | XQLZLFVKABIMJA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|