C11H25FN2O3S — CID 87665881
2-fluoro-1,3-dimethylimidazolidin-1-ium;hexane-1-sulfonate (PubChem CID 87665881) has the molecular formula C11H25FN2O3S and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethylimidazolidin-1-ium;hexane-1-sulfonate.
| Compound Name | 2-fluoro-1,3-dimethylimidazolidin-1-ium;hexane-1-sulfonate |
|---|---|
| PubChem CID | 87665881 |
| Molecular Formula | C11H25FN2O3S |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-fluoro-1,3-dimethylimidazolidin-1-ium;hexane-1-sulfonate |
| SMILES | CCCCCCS(=O)(=O)[O-].CN1CC[NH+](C)C1F |
| InChI | InChI=1S/C6H14O3S.C5H11FN2/c1-2-3-4-5-6-10(7,8)9;1-7-3-4-8(2)5(7)6/h2-6H2,1H3,(H,7,8,9);5H,3-4H2,1-2H3 |
| InChIKey | BAQGSFYVCAGSNU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|