C10H24N2O2 — CID 87666943
1-(6-ethoxyhexoxy)ethane-1,2-diamine (PubChem CID 87666943) has the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-(6-ethoxyhexoxy)ethane-1,2-diamine.
| Compound Name | 1-(6-ethoxyhexoxy)ethane-1,2-diamine |
|---|---|
| PubChem CID | 87666943 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | 1-(6-ethoxyhexoxy)ethane-1,2-diamine |
| SMILES | CCOCCCCCCOC(N)CN |
| InChI | InChI=1S/C10H24N2O2/c1-2-13-7-5-3-4-6-8-14-10(12)9-11/h10H,2-9,11-12H2,1H3 |
| InChIKey | OWBCZOVHTZTAOY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|