About 1-tetradecoxypropan-1-amine;hydrobromide
1-tetradecoxypropan-1-amine;hydrobromide (PubChem CID 173193932) has the molecular formula C17H38BrNO
and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-tetradecoxypropan-1-amine;hydrobromide.
Molecular Properties
| Compound Name | 1-tetradecoxypropan-1-amine;hydrobromide |
| PubChem CID | 173193932 |
| Molecular Formula | C17H38BrNO |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-tetradecoxypropan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCOC(N)CC |
| InChI | InChI=1S/C17H37NO.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)4-2;/h17H,3-16,18H2,1-2H3;1H |
| InChIKey | FAXULURAVJUWPB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-tetradecoxypropan-1-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tetradecoxypropan-1-amine;hydrobromide?
The IUPAC name of 1-tetradecoxypropan-1-amine;hydrobromide (CID 173193932) is 1-tetradecoxypropan-1-amine;hydrobromide.
What is the SMILES notation for 1-tetradecoxypropan-1-amine;hydrobromide?
The canonical SMILES for 1-tetradecoxypropan-1-amine;hydrobromide is Br.CCCCCCCCCCCCCCOC(N)CC.
What is the InChIKey of 1-tetradecoxypropan-1-amine;hydrobromide?
The InChIKey is FAXULURAVJUWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37NO.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)4-2;/h17H,3-16,18H2,1-2H3;1H.
What are the key properties of 1-tetradecoxypropan-1-amine;hydrobromide?
1-tetradecoxypropan-1-amine;hydrobromide has a molecular weight of 352.40 g/mol, XLogP of 5.98, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tetradecoxypropan-1-amine;hydrobromide is sourced from PubChem (CID 173193932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).