About 2-octoxypentan-3-amine
2-octoxypentan-3-amine (PubChem CID 43127877) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 2-octoxypentan-3-amine.
Molecular Properties
| Compound Name | 2-octoxypentan-3-amine |
| PubChem CID | 43127877 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 2-octoxypentan-3-amine |
| SMILES | CCCCCCCCOC(C)C(N)CC |
| InChI | InChI=1S/C13H29NO/c1-4-6-7-8-9-10-11-15-12(3)13(14)5-2/h12-13H,4-11,14H2,1-3H3 |
| InChIKey | YBPDICWDKABMLL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxypentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxypentan-3-amine?
The IUPAC name of 2-octoxypentan-3-amine (CID 43127877) is 2-octoxypentan-3-amine.
What is the SMILES notation for 2-octoxypentan-3-amine?
The canonical SMILES for 2-octoxypentan-3-amine is CCCCCCCCOC(C)C(N)CC.
What is the InChIKey of 2-octoxypentan-3-amine?
The InChIKey is YBPDICWDKABMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-4-6-7-8-9-10-11-15-12(3)13(14)5-2/h12-13H,4-11,14H2,1-3H3.
What are the key properties of 2-octoxypentan-3-amine?
2-octoxypentan-3-amine has a molecular weight of 215.38 g/mol, XLogP of 3.49, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxypentan-3-amine is sourced from PubChem (CID 43127877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).