About octoxymethanediamine
octoxymethanediamine (PubChem CID 142625053) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is octoxymethanediamine.
Molecular Properties
| Compound Name | octoxymethanediamine |
| PubChem CID | 142625053 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | octoxymethanediamine |
| SMILES | CCCCCCCCOC(N)N |
| InChI | InChI=1S/C9H22N2O/c1-2-3-4-5-6-7-8-12-9(10)11/h9H,2-8,10-11H2,1H3 |
| InChIKey | KXRIJTFZHYMODP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze octoxymethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octoxymethanediamine?
The IUPAC name of octoxymethanediamine (CID 142625053) is octoxymethanediamine.
What is the SMILES notation for octoxymethanediamine?
The canonical SMILES for octoxymethanediamine is CCCCCCCCOC(N)N.
What is the InChIKey of octoxymethanediamine?
The InChIKey is KXRIJTFZHYMODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-2-3-4-5-6-7-8-12-9(10)11/h9H,2-8,10-11H2,1H3.
What are the key properties of octoxymethanediamine?
octoxymethanediamine has a molecular weight of 174.29 g/mol, XLogP of 1.56, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octoxymethanediamine is sourced from PubChem (CID 142625053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).