About 1-pentoxyethanamine
1-pentoxyethanamine (PubChem CID 57262541) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-pentoxyethanamine.
Molecular Properties
| Compound Name | 1-pentoxyethanamine |
| PubChem CID | 57262541 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 1-pentoxyethanamine |
| SMILES | CCCCCOC(C)N |
| InChI | InChI=1S/C7H17NO/c1-3-4-5-6-9-7(2)8/h7H,3-6,8H2,1-2H3 |
| InChIKey | IYEXMAOAPCPYBN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxyethanamine?
The IUPAC name of 1-pentoxyethanamine (CID 57262541) is 1-pentoxyethanamine.
What is the SMILES notation for 1-pentoxyethanamine?
The canonical SMILES for 1-pentoxyethanamine is CCCCCOC(C)N.
What is the InChIKey of 1-pentoxyethanamine?
The InChIKey is IYEXMAOAPCPYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO/c1-3-4-5-6-9-7(2)8/h7H,3-6,8H2,1-2H3.
What are the key properties of 1-pentoxyethanamine?
1-pentoxyethanamine has a molecular weight of 131.22 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxyethanamine is sourced from PubChem (CID 57262541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).