C16H44N6 — CID 87669498
azane;4,4-bis(3-aminopropyl)-5-ethyloctane-1,8-diamine (PubChem CID 87669498) has the molecular formula C16H44N6 and a molecular weight of 320.57 g/mol. Its IUPAC name is azane;4,4-bis(3-aminopropyl)-5-ethyloctane-1,8-diamine.
| Compound Name | azane;4,4-bis(3-aminopropyl)-5-ethyloctane-1,8-diamine |
|---|---|
| PubChem CID | 87669498 |
| Molecular Formula | C16H44N6 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.36 |
| IUPAC Name | azane;4,4-bis(3-aminopropyl)-5-ethyloctane-1,8-diamine |
| SMILES | CCC(CCCN)C(CCCN)(CCCN)CCCN.N.N |
| InChI | InChI=1S/C16H38N4.2H3N/c1-2-15(7-3-11-17)16(8-4-12-18,9-5-13-19)10-6-14-20;;/h15H,2-14,17-20H2,1H3;2*1H3 |
| InChIKey | XGAMKLQJJRFPEJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 174.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |