About dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate)
dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) (PubChem CID 87669576) has the molecular formula C8H6MoN4O4S4
and a molecular weight of 446.37 g/mol. Its IUPAC name is dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate).
Molecular Properties
| Compound Name | dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) |
| PubChem CID | 87669576 |
| Molecular Formula | C8H6MoN4O4S4 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 447.83 |
| IUPAC Name | dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) |
| SMILES | O=[Mo+2]=O.S=C([S-])Nc1ncco1.S=C([S-])Nc1ncco1 |
| InChI | InChI=1S/2C4H4N2OS2.Mo.2O/c2*8-4(9)6-3-5-1-2-7-3;;;/h2*1-2H,(H2,5,6,8,9);;;/q;;+2;;/p-2 |
| InChIKey | NWEKYXUVPZQRIM-UHFFFAOYSA-L |
| XLogP | 1.60 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate)?
The IUPAC name of dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) (CID 87669576) is dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate).
What is the SMILES notation for dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate)?
The canonical SMILES for dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) is O=[Mo+2]=O.S=C([S-])Nc1ncco1.S=C([S-])Nc1ncco1.
What is the InChIKey of dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate)?
The InChIKey is NWEKYXUVPZQRIM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H4N2OS2.Mo.2O/c2*8-4(9)6-3-5-1-2-7-3;;;/h2*1-2H,(H2,5,6,8,9);;;/q;;+2;;/p-2.
What are the key properties of dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate)?
dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) has a molecular weight of 446.37 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dioxomolybdenum(2+);bis(N-(1,3-oxazol-2-yl)carbamodithioate) is sourced from PubChem (CID 87669576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).