C20H12MoN10O6S8 — CID 87511361
dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(1,3-oxazol-2-yl)carbamodithioate) (PubChem CID 87511361) has the molecular formula C20H12MoN10O6S8 and a molecular weight of 840.86 g/mol. Its IUPAC name is dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(1,3-oxazol-2-yl)carbamodithioate).
| Compound Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(1,3-oxazol-2-yl)carbamodithioate) |
|---|---|
| PubChem CID | 87511361 |
| Molecular Formula | C20H12MoN10O6S8 |
| Molecular Weight | 840.86 g/mol |
| Exact Mass | 841.78 |
| IUPAC Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(1,3-oxazol-2-yl)carbamodithioate) |
| SMILES | O=C(c1cnccn1)N(C(=S)S)N(C(=S)[S-])c1ncco1.O=C(c1cnccn1)N(C(=S)S)N(C(=S)[S-])c1ncco1.O=[Mo+2]=O |
| InChI | InChI=1S/2C10H7N5O2S4.Mo.2O/c2*16-7(6-5-11-1-2-12-6)14(9(18)19)15(10(20)21)8-13-3-4-17-8;;;/h2*1-5H,(H,18,19)(H,20,21);;;/q;;+2;;/p-2 |
| InChIKey | RVEPIVKTAOLLDK-UHFFFAOYSA-L |
| XLogP | 2.51 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.86 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|