C7H4MoN4O3S4 — CID 87668906
dioxomolybdenum(2+);N-(pyrazine-2-carbonyl)-N-(sulfidocarbothioylamino)carbamodithioate (PubChem CID 87668906) has the molecular formula C7H4MoN4O3S4 and a molecular weight of 416.34 g/mol. Its IUPAC name is dioxomolybdenum(2+);N-(pyrazine-2-carbonyl)-N-(sulfidocarbothioylamino)carbamodithioate.
| Compound Name | dioxomolybdenum(2+);N-(pyrazine-2-carbonyl)-N-(sulfidocarbothioylamino)carbamodithioate |
|---|---|
| PubChem CID | 87668906 |
| Molecular Formula | C7H4MoN4O3S4 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 417.82 |
| IUPAC Name | dioxomolybdenum(2+);N-(pyrazine-2-carbonyl)-N-(sulfidocarbothioylamino)carbamodithioate |
| SMILES | O=C(c1cnccn1)N(NC(=S)[S-])C(=S)[S-].O=[Mo+2]=O |
| InChI | InChI=1S/C7H6N4OS4.Mo.2O/c12-5(4-3-8-1-2-9-4)11(7(15)16)10-6(13)14;;;/h1-3H,(H,15,16)(H2,10,13,14);;;/q;+2;;/p-2 |
| InChIKey | KBSKCIPPDZFVJJ-UHFFFAOYSA-L |
| XLogP | -0.15 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|