C24H14MoN12O6S8 — CID 87511431
dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(pyrazine-2-carbonyl)carbamodithioate) (PubChem CID 87511431) has the molecular formula C24H14MoN12O6S8 and a molecular weight of 918.93 g/mol. Its IUPAC name is dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(pyrazine-2-carbonyl)carbamodithioate).
| Compound Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(pyrazine-2-carbonyl)carbamodithioate) |
|---|---|
| PubChem CID | 87511431 |
| Molecular Formula | C24H14MoN12O6S8 |
| Molecular Weight | 918.93 g/mol |
| Exact Mass | 919.80 |
| IUPAC Name | dioxomolybdenum(2+);bis(N-[dithiocarboxy(pyrazine-2-carbonyl)amino]-N-(pyrazine-2-carbonyl)carbamodithioate) |
| SMILES | O=C(c1cnccn1)N(C(=S)[S-])N(C(=O)c1cnccn1)C(=S)S.O=C(c1cnccn1)N(C(=S)[S-])N(C(=O)c1cnccn1)C(=S)S.O=[Mo+2]=O |
| InChI | InChI=1S/2C12H8N6O2S4.Mo.2O/c2*19-9(7-5-13-1-3-15-7)17(11(21)22)18(12(23)24)10(20)8-6-14-2-4-16-8;;;/h2*1-6H,(H,21,22)(H,23,24);;;/q;;+2;;/p-2 |
| InChIKey | LHXOIYFZXLHEDL-UHFFFAOYSA-L |
| XLogP | 1.39 |
| TPSA | 218.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.93 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|