C11H14N6OS4 — CID 87511826
[dithiocarboxy(piperazin-1-yl)amino]-(pyrazine-2-carbonyl)carbamodithioic acid (PubChem CID 87511826) has the molecular formula C11H14N6OS4 and a molecular weight of 374.54 g/mol. Its IUPAC name is [dithiocarboxy(piperazin-1-yl)amino]-(pyrazine-2-carbonyl)carbamodithioic acid.
| Compound Name | [dithiocarboxy(piperazin-1-yl)amino]-(pyrazine-2-carbonyl)carbamodithioic acid |
|---|---|
| PubChem CID | 87511826 |
| Molecular Formula | C11H14N6OS4 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | [dithiocarboxy(piperazin-1-yl)amino]-(pyrazine-2-carbonyl)carbamodithioic acid |
| SMILES | O=C(c1cnccn1)N(C(=S)S)N(C(=S)S)N1CCNCC1 |
| InChI | InChI=1S/C11H14N6OS4/c18-9(8-7-13-1-2-14-8)16(10(19)20)17(11(21)22)15-5-3-12-4-6-15/h1-2,7,12H,3-6H2,(H,19,20)(H,21,22) |
| InChIKey | NIUJNAIPXJXMLQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|