C10H15ClN4O — CID 71639489
(2-methylpiperazin-1-yl)-pyrazin-2-ylmethanone;hydrochloride (PubChem CID 71639489) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is (2-methylpiperazin-1-yl)-pyrazin-2-ylmethanone;hydrochloride.
| Compound Name | (2-methylpiperazin-1-yl)-pyrazin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 71639489 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2-methylpiperazin-1-yl)-pyrazin-2-ylmethanone;hydrochloride |
| SMILES | CC1CNCCN1C(=O)c1cnccn1.Cl |
| InChI | InChI=1S/C10H14N4O.ClH/c1-8-6-12-4-5-14(8)10(15)9-7-11-2-3-13-9;/h2-3,7-8,12H,4-6H2,1H3;1H |
| InChIKey | WKFKNSSSXILUPI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |