C15H25Cl2N5O — CID 119473452
(2-methylpiperazin-1-yl)-(1-pyrazin-2-ylpiperidin-4-yl)methanone;dihydrochloride (PubChem CID 119473452) has the molecular formula C15H25Cl2N5O and a molecular weight of 362.31 g/mol. Its IUPAC name is (2-methylpiperazin-1-yl)-(1-pyrazin-2-ylpiperidin-4-yl)methanone;dihydrochloride.
| Compound Name | (2-methylpiperazin-1-yl)-(1-pyrazin-2-ylpiperidin-4-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119473452 |
| Molecular Formula | C15H25Cl2N5O |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (2-methylpiperazin-1-yl)-(1-pyrazin-2-ylpiperidin-4-yl)methanone;dihydrochloride |
| SMILES | CC1CNCCN1C(=O)C1CCN(c2cnccn2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H23N5O.2ClH/c1-12-10-17-6-9-20(12)15(21)13-2-7-19(8-3-13)14-11-16-4-5-18-14;;/h4-5,11-13,17H,2-3,6-10H2,1H3;2*1H |
| InChIKey | OMUSGAQDTUXDPG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |