C22H30N2O3 — CID 87671884
cyclohexyl 2-phenyl-4-(2-propan-2-ylimidazol-1-yl)butaneperoxoate (PubChem CID 87671884) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is cyclohexyl 2-phenyl-4-(2-propan-2-ylimidazol-1-yl)butaneperoxoate.
| Compound Name | cyclohexyl 2-phenyl-4-(2-propan-2-ylimidazol-1-yl)butaneperoxoate |
|---|---|
| PubChem CID | 87671884 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | cyclohexyl 2-phenyl-4-(2-propan-2-ylimidazol-1-yl)butaneperoxoate |
| SMILES | CC(C)c1nccn1CCC(C(=O)OOC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O3/c1-17(2)21-23-14-16-24(21)15-13-20(18-9-5-3-6-10-18)22(25)27-26-19-11-7-4-8-12-19/h3,5-6,9-10,14,16-17,19-20H,4,7-8,11-13,15H2,1-2H3 |
| InChIKey | MXEXQEIXAKHNIM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|