C12H24N3O4+ — CID 8767198
[2-(tert-butylamino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-methylazanium (PubChem CID 8767198) has the molecular formula C12H24N3O4+ and a molecular weight of 274.34 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8767198 |
| Molecular Formula | C12H24N3O4+ |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(ethoxycarbonylamino)-2-oxoethyl]-methylazanium |
| SMILES | CCOC(=O)NC(=O)C[NH+](C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-6-19-11(18)13-9(16)7-15(5)8-10(17)14-12(2,3)4/h6-8H2,1-5H3,(H,14,17)(H,13,16,18)/p+1 |
| InChIKey | PJKWEIMGGPQWCE-UHFFFAOYSA-O |
| XLogP | -1.31 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |