C24H25N4O3S+ — CID 87673241
2-[3-[(Z)-C-(3,4-dimethoxyphenyl)-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbonimidoyl]pyridin-1-ium-1-yl]ethanol (PubChem CID 87673241) has the molecular formula C24H25N4O3S+ and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-[3-[(Z)-C-(3,4-dimethoxyphenyl)-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbonimidoyl]pyridin-1-ium-1-yl]ethanol.
| Compound Name | 2-[3-[(Z)-C-(3,4-dimethoxyphenyl)-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbonimidoyl]pyridin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 87673241 |
| Molecular Formula | C24H25N4O3S+ |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[3-[(Z)-C-(3,4-dimethoxyphenyl)-N-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]carbonimidoyl]pyridin-1-ium-1-yl]ethanol |
| SMILES | COc1ccc(/C(=N/N=c2/sc3ccccc3n2C)c2ccc[n+](CCO)c2)cc1OC |
| InChI | InChI=1S/C24H25N4O3S/c1-27-19-8-4-5-9-22(19)32-24(27)26-25-23(18-7-6-12-28(16-18)13-14-29)17-10-11-20(30-2)21(15-17)31-3/h4-12,15-16,29H,13-14H2,1-3H3/q+1/b25-23-,26-24+ |
| InChIKey | RHSGQSPWVDMROU-MJPLYFDISA-N |
| XLogP | 2.89 |
| TPSA | 72.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|