C17H26N4O3 — CID 8767331
4-[[(2S)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]propanoyl]amino]benzamide (PubChem CID 8767331) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-[[(2S)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2S)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 8767331 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 4-[[(2S)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]propanoyl]amino]benzamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(C(N)=O)cc1)N(C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H26N4O3/c1-11(21(5)10-14(22)20-17(2,3)4)16(24)19-13-8-6-12(7-9-13)15(18)23/h6-9,11H,10H2,1-5H3,(H2,18,23)(H,19,24)(H,20,22)/t11-/m0/s1 |
| InChIKey | VUUYOWXYXPYDEH-NSHDSACASA-N |
| XLogP | 0.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |