C17H21BrN4O2 — CID 96541344
4-[[(2R)-2-[(4-bromo-1-methylpyrrol-2-yl)methyl-methylamino]propanoyl]amino]benzamide (PubChem CID 96541344) has the molecular formula C17H21BrN4O2 and a molecular weight of 393.29 g/mol. Its IUPAC name is 4-[[(2R)-2-[(4-bromo-1-methylpyrrol-2-yl)methyl-methylamino]propanoyl]amino]benzamide.
| Compound Name | 4-[[(2R)-2-[(4-bromo-1-methylpyrrol-2-yl)methyl-methylamino]propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 96541344 |
| Molecular Formula | C17H21BrN4O2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-[[(2R)-2-[(4-bromo-1-methylpyrrol-2-yl)methyl-methylamino]propanoyl]amino]benzamide |
| SMILES | C[C@H](C(=O)Nc1ccc(C(N)=O)cc1)N(C)Cc1cc(Br)cn1C |
| InChI | InChI=1S/C17H21BrN4O2/c1-11(21(2)10-15-8-13(18)9-22(15)3)17(24)20-14-6-4-12(5-7-14)16(19)23/h4-9,11H,10H2,1-3H3,(H2,19,23)(H,20,24)/t11-/m1/s1 |
| InChIKey | MIXMRTPZHJCOGI-LLVKDONJSA-N |
| XLogP | 2.35 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |