C18H30N3O2+ — CID 8767377
[2-(tert-butylamino)-2-oxoethyl]-[(2R)-1-(N-ethylanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8767377) has the molecular formula C18H30N3O2+ and a molecular weight of 320.46 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[(2R)-1-(N-ethylanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[(2R)-1-(N-ethylanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8767377 |
| Molecular Formula | C18H30N3O2+ |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[(2R)-1-(N-ethylanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | CCN(C(=O)[C@@H](C)[NH+](C)CC(=O)NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29N3O2/c1-7-21(15-11-9-8-10-12-15)17(23)14(2)20(6)13-16(22)19-18(3,4)5/h8-12,14H,7,13H2,1-6H3,(H,19,22)/p+1/t14-/m1/s1 |
| InChIKey | MSLRMYWJHFBUGC-CQSZACIVSA-O |
| XLogP | 0.86 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |