C17H26FN3O2 — CID 8767568
N-tert-butyl-2-[[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl]-methylamino]acetamide (PubChem CID 8767568) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 8767568 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-tert-butyl-2-[[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)CC(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H26FN3O2/c1-17(2,3)19-15(22)11-20(4)12-16(23)21(5)10-13-7-6-8-14(18)9-13/h6-9H,10-12H2,1-5H3,(H,19,22) |
| InChIKey | MWMHZXQBQVXPTL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |