C16H27N3O3S — CID 86908532
N-tert-butyl-2-[[3-(dimethylsulfamoyl)phenyl]methyl-methylamino]acetamide (PubChem CID 86908532) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is N-tert-butyl-2-[[3-(dimethylsulfamoyl)phenyl]methyl-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[3-(dimethylsulfamoyl)phenyl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 86908532 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-tert-butyl-2-[[3-(dimethylsulfamoyl)phenyl]methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)Cc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H27N3O3S/c1-16(2,3)17-15(20)12-19(6)11-13-8-7-9-14(10-13)23(21,22)18(4)5/h7-10H,11-12H2,1-6H3,(H,17,20) |
| InChIKey | DRUFANWZXMMZJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |