C23H26N5O4S+ — CID 87677894
(2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(1S)-1-(4-nitrophenyl)ethyl]pyrrolidin-1-ium-2-carboxamide (PubChem CID 87677894) has the molecular formula C23H26N5O4S+ and a molecular weight of 468.56 g/mol. Its IUPAC name is (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(1S)-1-(4-nitrophenyl)ethyl]pyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(1S)-1-(4-nitrophenyl)ethyl]pyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87677894 |
| Molecular Formula | C23H26N5O4S+ |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(1S)-1-(4-nitrophenyl)ethyl]pyrrolidin-1-ium-2-carboxamide |
| SMILES | C[C@@H](c1ccc([N+](=O)[O-])cc1)[N+]1(C(=O)CSc2nc3ccccc3n2C)CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C23H25N5O4S/c1-15(16-9-11-17(12-10-16)27(31)32)28(13-5-8-20(28)22(24)30)21(29)14-33-23-25-18-6-3-4-7-19(18)26(23)2/h3-4,6-7,9-12,15,20H,5,8,13-14H2,1-2H3,(H-,24,30)/p+1/t15-,20-,28?/m0/s1 |
| InChIKey | HEMSENLLJMKNPS-JAXBVWALSA-O |
| XLogP | 3.33 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|