C21H21ClFN5O3 — CID 87678799
2-[(6-chloro-2-pyridinyl)oxymethyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]morpholine-4-carboxamide (PubChem CID 87678799) has the molecular formula C21H21ClFN5O3 and a molecular weight of 445.88 g/mol. Its IUPAC name is 2-[(6-chloro-2-pyridinyl)oxymethyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]morpholine-4-carboxamide.
| Compound Name | 2-[(6-chloro-2-pyridinyl)oxymethyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 87678799 |
| Molecular Formula | C21H21ClFN5O3 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[(6-chloro-2-pyridinyl)oxymethyl]-N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(F)cc2)c1)N1CCOC(COc2cccc(Cl)n2)C1 |
| InChI | InChI=1S/C21H21ClFN5O3/c22-19-2-1-3-20(26-19)31-14-18-13-27(8-9-30-18)21(29)25-17-10-24-28(12-17)11-15-4-6-16(23)7-5-15/h1-7,10,12,18H,8-9,11,13-14H2,(H,25,29) |
| InChIKey | YWRJQUROJUGBML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|