C16H18FN5O3 — CID 95134155
(2R)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-fluorophenyl)morpholine-4-carboxamide (PubChem CID 95134155) has the molecular formula C16H18FN5O3 and a molecular weight of 347.35 g/mol. Its IUPAC name is (2R)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-fluorophenyl)morpholine-4-carboxamide.
| Compound Name | (2R)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-fluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 95134155 |
| Molecular Formula | C16H18FN5O3 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (2R)-N-[1-(2-amino-2-oxoethyl)pyrazol-4-yl]-2-(4-fluorophenyl)morpholine-4-carboxamide |
| SMILES | NC(=O)Cn1cc(NC(=O)N2CCO[C@H](c3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C16H18FN5O3/c17-12-3-1-11(2-4-12)14-9-21(5-6-25-14)16(24)20-13-7-19-22(8-13)10-15(18)23/h1-4,7-8,14H,5-6,9-10H2,(H2,18,23)(H,20,24)/t14-/m0/s1 |
| InChIKey | XPGQNUVUNPYCIY-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |