C16H18FNO — CID 87679938
3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal (PubChem CID 87679938) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal.
| Compound Name | 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 87679938 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal |
| SMILES | C=C[C@@H]1CCC[C@H](c2ccc(F)cc2)N1C=CC=O |
| InChI | InChI=1S/C16H18FNO/c1-2-15-5-3-6-16(18(15)11-4-12-19)13-7-9-14(17)10-8-13/h2,4,7-12,15-16H,1,3,5-6H2/t15-,16-/m1/s1 |
| InChIKey | NKOSOBFCWVNWMN-HZPDHXFCSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|