About 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal
3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal (PubChem CID 87679938) has the molecular formula C16H18FNO
and a molecular weight of 259.32 g/mol. Its IUPAC name is 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal.
Molecular Properties
| Compound Name | 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal |
| PubChem CID | 87679938 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal |
| SMILES | C=C[C@@H]1CCC[C@H](c2ccc(F)cc2)N1C=CC=O |
| InChI | InChI=1S/C16H18FNO/c1-2-15-5-3-6-16(18(15)11-4-12-19)13-7-9-14(17)10-8-13/h2,4,7-12,15-16H,1,3,5-6H2/t15-,16-/m1/s1 |
| InChIKey | NKOSOBFCWVNWMN-HZPDHXFCSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal?
The IUPAC name of 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal (CID 87679938) is 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal.
What is the SMILES notation for 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal?
The canonical SMILES for 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal is C=C[C@@H]1CCC[C@H](c2ccc(F)cc2)N1C=CC=O.
What is the InChIKey of 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal?
The InChIKey is NKOSOBFCWVNWMN-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H18FNO/c1-2-15-5-3-6-16(18(15)11-4-12-19)13-7-9-14(17)10-8-13/h2,4,7-12,15-16H,1,3,5-6H2/t15-,16-/m1/s1.
What are the key properties of 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal?
3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal has a molecular weight of 259.32 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,6R)-2-ethenyl-6-(4-fluorophenyl)piperidin-1-yl]prop-2-enal is sourced from PubChem (CID 87679938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).