C19H22FNO3 — CID 91157381
methyl 3-[(2R,6S)-1-but-3-enoyl-6-(4-fluorophenyl)piperidin-2-yl]prop-2-enoate (PubChem CID 91157381) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl 3-[(2R,6S)-1-but-3-enoyl-6-(4-fluorophenyl)piperidin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[(2R,6S)-1-but-3-enoyl-6-(4-fluorophenyl)piperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91157381 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | methyl 3-[(2R,6S)-1-but-3-enoyl-6-(4-fluorophenyl)piperidin-2-yl]prop-2-enoate |
| SMILES | C=CCC(=O)N1[C@@H](C=CC(=O)OC)CCC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNO3/c1-3-5-18(22)21-16(12-13-19(23)24-2)6-4-7-17(21)14-8-10-15(20)11-9-14/h3,8-13,16-17H,1,4-7H2,2H3/t16-,17+/m1/s1 |
| InChIKey | RESUTTDWCIDNOC-SJORKVTESA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|