C26H27F6N3O6S2 — CID 87684823
[7-[(1R)-2-[2-[3-[(2S)-2-amino-2-phenylethoxy]propylsulfanyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 87684823) has the molecular formula C26H27F6N3O6S2 and a molecular weight of 655.64 g/mol. Its IUPAC name is [7-[(1R)-2-[2-[3-[(2S)-2-amino-2-phenylethoxy]propylsulfanyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-[(1R)-2-[2-[3-[(2S)-2-amino-2-phenylethoxy]propylsulfanyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87684823 |
| Molecular Formula | C26H27F6N3O6S2 |
| Molecular Weight | 655.64 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | [7-[(1R)-2-[2-[3-[(2S)-2-amino-2-phenylethoxy]propylsulfanyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | N[C@H](COCCCSCCNC[C@H](OC(=O)C(F)(F)F)c1ccc(OC(=O)C(F)(F)F)c2[nH]c(=O)sc12)c1ccccc1 |
| InChI | InChI=1S/C26H27F6N3O6S2/c27-25(28,29)22(36)40-18-8-7-16(21-20(18)35-24(38)43-21)19(41-23(37)26(30,31)32)13-34-9-12-42-11-4-10-39-14-17(33)15-5-2-1-3-6-15/h1-3,5-8,17,19,34H,4,9-14,33H2,(H,35,38)/t17-,19+/m1/s1 |
| InChIKey | YEZKBUCZYVHDNT-MJGOQNOKSA-N |
| XLogP | 4.63 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|