C19H21FN2O4 — CID 87687775
[4-[(3-fluorophenyl)methoxy]phenyl]methyl-[(1E)-1-methoxyiminopropan-2-yl]carbamic acid (PubChem CID 87687775) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is [4-[(3-fluorophenyl)methoxy]phenyl]methyl-[(1E)-1-methoxyiminopropan-2-yl]carbamic acid.
| Compound Name | [4-[(3-fluorophenyl)methoxy]phenyl]methyl-[(1E)-1-methoxyiminopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87687775 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [4-[(3-fluorophenyl)methoxy]phenyl]methyl-[(1E)-1-methoxyiminopropan-2-yl]carbamic acid |
| SMILES | CO/N=C/C(C)N(Cc1ccc(OCc2cccc(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C19H21FN2O4/c1-14(11-21-25-2)22(19(23)24)12-15-6-8-18(9-7-15)26-13-16-4-3-5-17(20)10-16/h3-11,14H,12-13H2,1-2H3,(H,23,24)/b21-11+ |
| InChIKey | QISGXLJHXLQJPE-SRZZPIQSSA-N |
| XLogP | 3.91 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|