benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid

C18H17F2NO2 — CID 69471598

IUPACbenzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid
SMILESCC(C=Cc1cc(F)ccc1F)N(Cc1ccccc1)C(=O)O
InChIInChI=1S/C18H17F2NO2/c1-13(7-8-15-11-16(19)9-10-17(15)20)21(18(22)23)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,23)
InChIKeyDDUFRDHZPIHBDX-UHFFFAOYSA-N
MW317.34 g/mol
LogP4.55
Rot. Bonds5

About benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid

benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid (PubChem CID 69471598) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid.

Molecular Properties

Compound Namebenzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid
PubChem CID69471598
Molecular FormulaC18H17F2NO2
Molecular Weight317.34 g/mol
Exact Mass317.12
IUPAC Namebenzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid
SMILESCC(C=Cc1cc(F)ccc1F)N(Cc1ccccc1)C(=O)O
InChIInChI=1S/C18H17F2NO2/c1-13(7-8-15-11-16(19)9-10-17(15)20)21(18(22)23)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,23)
InChIKeyDDUFRDHZPIHBDX-UHFFFAOYSA-N
XLogP4.55
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.34
LogP ≤ 54.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid?
The IUPAC name of benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid (CID 69471598) is benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid.
What is the SMILES notation for benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid?
The canonical SMILES for benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid is CC(C=Cc1cc(F)ccc1F)N(Cc1ccccc1)C(=O)O.
What is the InChIKey of benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid?
The InChIKey is DDUFRDHZPIHBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F2NO2/c1-13(7-8-15-11-16(19)9-10-17(15)20)21(18(22)23)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,23).
What are the key properties of benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid?
benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid has a molecular weight of 317.34 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid is sourced from PubChem (CID 69471598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).