C18H17F2NO2 — CID 69471598
benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid (PubChem CID 69471598) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid.
| Compound Name | benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69471598 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | benzyl-[4-(2,5-difluorophenyl)but-3-en-2-yl]carbamic acid |
| SMILES | CC(C=Cc1cc(F)ccc1F)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H17F2NO2/c1-13(7-8-15-11-16(19)9-10-17(15)20)21(18(22)23)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,22,23) |
| InChIKey | DDUFRDHZPIHBDX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |