C17H17F2NO — CID 62051545
2-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)propan-1-one (PubChem CID 62051545) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)propan-1-one.
| Compound Name | 2-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 62051545 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(F)cc1F)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C17H17F2NO/c1-12(20(2)11-13-6-4-3-5-7-13)17(21)15-9-8-14(18)10-16(15)19/h3-10,12H,11H2,1-2H3 |
| InChIKey | LMJVNLQUZOQZTH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |