C21H29BrN6O2 — CID 87689947
tert-butyl N-[(3S)-1-[3-[(3-amino-6-bromo-2-pyridinyl)methylamino]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 87689947) has the molecular formula C21H29BrN6O2 and a molecular weight of 477.41 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[3-[(3-amino-6-bromo-2-pyridinyl)methylamino]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[3-[(3-amino-6-bromo-2-pyridinyl)methylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87689947 |
| Molecular Formula | C21H29BrN6O2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-[3-[(3-amino-6-bromo-2-pyridinyl)methylamino]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2ccncc2NCc2nc(Br)ccc2N)C1 |
| InChI | InChI=1S/C21H29BrN6O2/c1-21(2,3)30-20(29)26-14-5-4-10-28(13-14)18-8-9-24-11-17(18)25-12-16-15(23)6-7-19(22)27-16/h6-9,11,14,25H,4-5,10,12-13,23H2,1-3H3,(H,26,29)/t14-/m0/s1 |
| InChIKey | JBNZWOBLISUISX-AWEZNQCLSA-N |
| XLogP | 3.93 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|