C11H12Cl2N4O2 — CID 87690825
N-(2,3-dichloro-4-pyridinyl)-2-oxo-2-piperazin-1-ylacetamide (PubChem CID 87690825) has the molecular formula C11H12Cl2N4O2 and a molecular weight of 303.15 g/mol. Its IUPAC name is N-(2,3-dichloro-4-pyridinyl)-2-oxo-2-piperazin-1-ylacetamide.
| Compound Name | N-(2,3-dichloro-4-pyridinyl)-2-oxo-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 87690825 |
| Molecular Formula | C11H12Cl2N4O2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | N-(2,3-dichloro-4-pyridinyl)-2-oxo-2-piperazin-1-ylacetamide |
| SMILES | O=C(Nc1ccnc(Cl)c1Cl)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H12Cl2N4O2/c12-8-7(1-2-15-9(8)13)16-10(18)11(19)17-5-3-14-4-6-17/h1-2,14H,3-6H2,(H,15,16,18) |
| InChIKey | TVFDVADUGQKPDN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|