C24H19Cl2FN6O — CID 87693216
N-[(1S)-1-(1,8-dichloro-5-fluoroisoquinolin-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine (PubChem CID 87693216) has the molecular formula C24H19Cl2FN6O and a molecular weight of 497.36 g/mol. Its IUPAC name is N-[(1S)-1-(1,8-dichloro-5-fluoroisoquinolin-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine.
| Compound Name | N-[(1S)-1-(1,8-dichloro-5-fluoroisoquinolin-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 87693216 |
| Molecular Formula | C24H19Cl2FN6O |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N-[(1S)-1-(1,8-dichloro-5-fluoroisoquinolin-3-yl)ethyl]-9-[(4-methoxyphenyl)methyl]purin-6-amine |
| SMILES | COc1ccc(Cn2cnc3c(N[C@@H](C)c4cc5c(F)ccc(Cl)c5c(Cl)n4)ncnc32)cc1 |
| InChI | InChI=1S/C24H19Cl2FN6O/c1-13(19-9-16-18(27)8-7-17(25)20(16)22(26)32-19)31-23-21-24(29-11-28-23)33(12-30-21)10-14-3-5-15(34-2)6-4-14/h3-9,11-13H,10H2,1-2H3,(H,28,29,31)/t13-/m0/s1 |
| InChIKey | SYAJHVDXNPOWEC-ZDUSSCGKSA-N |
| XLogP | 6.05 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|