C18H14Br4O4 — CID 87695669
[2,3-bis(bromomethyl)benzoyl] 2,3-bis(bromomethyl)benzenecarboperoxoate (PubChem CID 87695669) has the molecular formula C18H14Br4O4 and a molecular weight of 613.92 g/mol. Its IUPAC name is [2,3-bis(bromomethyl)benzoyl] 2,3-bis(bromomethyl)benzenecarboperoxoate.
| Compound Name | [2,3-bis(bromomethyl)benzoyl] 2,3-bis(bromomethyl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 87695669 |
| Molecular Formula | C18H14Br4O4 |
| Molecular Weight | 613.92 g/mol |
| Exact Mass | 609.76 |
| IUPAC Name | [2,3-bis(bromomethyl)benzoyl] 2,3-bis(bromomethyl)benzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1cccc(CBr)c1CBr)c1cccc(CBr)c1CBr |
| InChI | InChI=1S/C18H14Br4O4/c19-7-11-3-1-5-13(15(11)9-21)17(23)25-26-18(24)14-6-2-4-12(8-20)16(14)10-22/h1-6H,7-10H2 |
| InChIKey | KAVJSBVAQJNGCD-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.92 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|