C54H63F2N5O6S — CID 87696722
ethyl 2,5-bis[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 87696722) has the molecular formula C54H63F2N5O6S and a molecular weight of 948.19 g/mol. Its IUPAC name is ethyl 2,5-bis[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2,5-bis[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 87696722 |
| Molecular Formula | C54H63F2N5O6S |
| Molecular Weight | 948.19 g/mol |
| Exact Mass | 947.45 |
| IUPAC Name | ethyl 2,5-bis[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc2sc(N(Cc3cc(OCC)c(-c4ccc(F)cc4)c(OCC)c3)C3CCNCC3)nc2cc1N(Cc1cc(OCC)c(-c2ccc(F)cc2)c(OCC)c1)C1CCNCC1 |
| InChI | InChI=1S/C54H63F2N5O6S/c1-6-63-46-27-35(28-47(64-7-2)51(46)37-11-15-39(55)16-12-37)33-60(41-19-23-57-24-20-41)45-32-44-50(31-43(45)53(62)67-10-5)68-54(59-44)61(42-21-25-58-26-22-42)34-36-29-48(65-8-3)52(49(30-36)66-9-4)38-13-17-40(56)18-14-38/h11-18,27-32,41-42,57-58H,6-10,19-26,33-34H2,1-5H3 |
| InChIKey | NBUPNLLEYHKQGD-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.19 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |